C27H27N3O3 — CID 11633590
N-methyl-3-phenyl-2-(propan-2-ylcarbamoyl)-5-(2-pyridin-2-ylethoxy)inden-1-imine oxide (PubChem CID 11633590) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-methyl-3-phenyl-2-(propan-2-ylcarbamoyl)-5-(2-pyridin-2-ylethoxy)inden-1-imine oxide.
| Compound Name | N-methyl-3-phenyl-2-(propan-2-ylcarbamoyl)-5-(2-pyridin-2-ylethoxy)inden-1-imine oxide |
|---|---|
| PubChem CID | 11633590 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-methyl-3-phenyl-2-(propan-2-ylcarbamoyl)-5-(2-pyridin-2-ylethoxy)inden-1-imine oxide |
| SMILES | CC(C)NC(=O)C1=C(c2ccccc2)c2cc(OCCc3ccccn3)ccc2/C1=[N+](/C)[O-] |
| InChI | InChI=1S/C27H27N3O3/c1-18(2)29-27(31)25-24(19-9-5-4-6-10-19)23-17-21(12-13-22(23)26(25)30(3)32)33-16-14-20-11-7-8-15-28-20/h4-13,15,17-18H,14,16H2,1-3H3,(H,29,31)/b30-26+ |
| InChIKey | QYOCNLIYXBSRQW-URGPHPNLSA-N |
| XLogP | 3.97 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|