C26H32F3NO2 — CID 11633727
(1S)-1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2,2,2-trifluoro-1-phenylethanol (PubChem CID 11633727) has the molecular formula C26H32F3NO2 and a molecular weight of 447.54 g/mol. Its IUPAC name is (1S)-1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2,2,2-trifluoro-1-phenylethanol.
| Compound Name | (1S)-1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2,2,2-trifluoro-1-phenylethanol |
|---|---|
| PubChem CID | 11633727 |
| Molecular Formula | C26H32F3NO2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | (1S)-1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2,2,2-trifluoro-1-phenylethanol |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H]([C@@](O)(c1ccccc1)C(F)(F)F)N(Cc1ccccc1)C2(C)C |
| InChI | InChI=1S/C26H32F3NO2/c1-18-14-15-21-22(16-18)32-23(25(31,26(27,28)29)20-12-8-5-9-13-20)30(24(21,2)3)17-19-10-6-4-7-11-19/h4-13,18,21-23,31H,14-17H2,1-3H3/t18-,21-,22-,23+,25+/m1/s1 |
| InChIKey | JYQFUSVPYZNBIU-LOAAWLJNSA-N |
| XLogP | 5.88 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |