C20H24F3N5O2S — CID 11633885
N-pentyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 11633885) has the molecular formula C20H24F3N5O2S and a molecular weight of 455.51 g/mol. Its IUPAC name is N-pentyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-pentyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 11633885 |
| Molecular Formula | C20H24F3N5O2S |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-pentyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCCCCNC(=O)c1nnc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)s1 |
| InChI | InChI=1S/C20H24F3N5O2S/c1-2-3-6-9-24-16(29)17-25-26-19(31-17)28-12-10-27(11-13-28)18(30)14-7-4-5-8-15(14)20(21,22)23/h4-5,7-8H,2-3,6,9-13H2,1H3,(H,24,29) |
| InChIKey | HNWFOZVENMGHCT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|