C28H50O3Si — CID 11634039
ethyl (2E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-2-(4-methylpent-3-enyl)dodeca-2,6,10-trienoate (PubChem CID 11634039) has the molecular formula C28H50O3Si and a molecular weight of 462.79 g/mol. Its IUPAC name is ethyl (2E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-2-(4-methylpent-3-enyl)dodeca-2,6,10-trienoate.
| Compound Name | ethyl (2E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-2-(4-methylpent-3-enyl)dodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 11634039 |
| Molecular Formula | C28H50O3Si |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | ethyl (2E,6E,10E)-12-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-2-(4-methylpent-3-enyl)dodeca-2,6,10-trienoate |
| SMILES | CCOC(=O)/C(=C/CC/C(C)=C/CC/C(C)=C/CO[Si](C)(C)C(C)(C)C)CCC=C(C)C |
| InChI | InChI=1S/C28H50O3Si/c1-11-30-27(29)26(19-12-15-23(2)3)20-14-18-24(4)16-13-17-25(5)21-22-31-32(9,10)28(6,7)8/h15-16,20-21H,11-14,17-19,22H2,1-10H3/b24-16+,25-21+,26-20+ |
| InChIKey | YEFUHKABZDPRIA-BNROLGQQSA-N |
| XLogP | 8.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|