C23H18BrNO3S2 — CID 11634727
ethyl 3-(4-bromobenzoyl)-1-prop-2-enylsulfanylthieno[3,4-b]indolizine-4-carboxylate (PubChem CID 11634727) has the molecular formula C23H18BrNO3S2 and a molecular weight of 500.44 g/mol. Its IUPAC name is ethyl 3-(4-bromobenzoyl)-1-prop-2-enylsulfanylthieno[3,4-b]indolizine-4-carboxylate.
| Compound Name | ethyl 3-(4-bromobenzoyl)-1-prop-2-enylsulfanylthieno[3,4-b]indolizine-4-carboxylate |
|---|---|
| PubChem CID | 11634727 |
| Molecular Formula | C23H18BrNO3S2 |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 498.99 |
| IUPAC Name | ethyl 3-(4-bromobenzoyl)-1-prop-2-enylsulfanylthieno[3,4-b]indolizine-4-carboxylate |
| SMILES | C=CCSc1sc(C(=O)c2ccc(Br)cc2)c2c(C(=O)OCC)c3ccccn3c12 |
| InChI | InChI=1S/C23H18BrNO3S2/c1-3-13-29-23-19-18(21(30-23)20(26)14-8-10-15(24)11-9-14)17(22(27)28-4-2)16-7-5-6-12-25(16)19/h3,5-12H,1,4,13H2,2H3 |
| InChIKey | JUQQHLVTGMPZAK-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|