C34H38FN3O2 — CID 11635234
(3R,4S)-N-cyclopropyl-4-[3-(4-fluorophenyl)phenyl]-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide (PubChem CID 11635234) has the molecular formula C34H38FN3O2 and a molecular weight of 539.70 g/mol. Its IUPAC name is (3R,4S)-N-cyclopropyl-4-[3-(4-fluorophenyl)phenyl]-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide.
| Compound Name | (3R,4S)-N-cyclopropyl-4-[3-(4-fluorophenyl)phenyl]-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 11635234 |
| Molecular Formula | C34H38FN3O2 |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | (3R,4S)-N-cyclopropyl-4-[3-(4-fluorophenyl)phenyl]-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide |
| SMILES | COCCCn1cc(CN(C(=O)[C@H]2CNCC[C@@H]2c2cccc(-c3ccc(F)cc3)c2)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C34H38FN3O2/c1-40-19-5-18-37-22-27(31-8-2-3-9-33(31)37)23-38(29-14-15-29)34(39)32-21-36-17-16-30(32)26-7-4-6-25(20-26)24-10-12-28(35)13-11-24/h2-4,6-13,20,22,29-30,32,36H,5,14-19,21,23H2,1H3/t30-,32+/m1/s1 |
| InChIKey | VTNKZTOJBXEVTO-BHYZAODMSA-N |
| XLogP | 6.37 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|