C27H33BrN4O3 — CID 11635249
1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)-1,4-diazepan-1-yl]butyl]urea (PubChem CID 11635249) has the molecular formula C27H33BrN4O3 and a molecular weight of 541.49 g/mol. Its IUPAC name is 1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)-1,4-diazepan-1-yl]butyl]urea.
| Compound Name | 1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)-1,4-diazepan-1-yl]butyl]urea |
|---|---|
| PubChem CID | 11635249 |
| Molecular Formula | C27H33BrN4O3 |
| Molecular Weight | 541.49 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)-1,4-diazepan-1-yl]butyl]urea |
| SMILES | NC(=O)N(CCCCN1CCCN(c2cccc3c2OCCC3)CC1)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C27H33BrN4O3/c28-22-9-10-24-21(18-22)19-25(35-24)32(27(29)33)14-2-1-11-30-12-5-13-31(16-15-30)23-8-3-6-20-7-4-17-34-26(20)23/h3,6,8-10,18-19H,1-2,4-5,7,11-17H2,(H2,29,33) |
| InChIKey | CSLPKQDQGKKOBG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|