C35H35NO6 — CID 11635481
ditert-butyl 5-(2,6-dimethylphenyl)imino-10'-oxospiro[furan-2,9'-phenanthrene]-3,4-dicarboxylate (PubChem CID 11635481) has the molecular formula C35H35NO6 and a molecular weight of 565.67 g/mol. Its IUPAC name is ditert-butyl 5-(2,6-dimethylphenyl)imino-10'-oxospiro[furan-2,9'-phenanthrene]-3,4-dicarboxylate.
| Compound Name | ditert-butyl 5-(2,6-dimethylphenyl)imino-10'-oxospiro[furan-2,9'-phenanthrene]-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11635481 |
| Molecular Formula | C35H35NO6 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | ditert-butyl 5-(2,6-dimethylphenyl)imino-10'-oxospiro[furan-2,9'-phenanthrene]-3,4-dicarboxylate |
| SMILES | Cc1cccc(C)c1/N=C1\OC2(C(=O)c3ccccc3-c3ccccc32)C(C(=O)OC(C)(C)C)=C1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H35NO6/c1-20-14-13-15-21(2)28(20)36-30-26(31(38)41-33(3,4)5)27(32(39)42-34(6,7)8)35(40-30)25-19-12-11-17-23(25)22-16-9-10-18-24(22)29(35)37/h9-19H,1-8H3/b36-30- |
| InChIKey | UGROPUGKKAVAAP-BBTNWVSFSA-N |
| XLogP | 7.10 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|