C40H53NO6Si — CID 11636081
1-O-tert-butyl 2-O-[(E)-6-[tert-butyl(diphenyl)silyl]oxyhex-2-enyl] (5S)-5-(phenylmethoxymethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 11636081) has the molecular formula C40H53NO6Si and a molecular weight of 671.95 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[(E)-6-[tert-butyl(diphenyl)silyl]oxyhex-2-enyl] (5S)-5-(phenylmethoxymethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-[(E)-6-[tert-butyl(diphenyl)silyl]oxyhex-2-enyl] (5S)-5-(phenylmethoxymethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11636081 |
| Molecular Formula | C40H53NO6Si |
| Molecular Weight | 671.95 g/mol |
| Exact Mass | 671.36 |
| IUPAC Name | 1-O-tert-butyl 2-O-[(E)-6-[tert-butyl(diphenyl)silyl]oxyhex-2-enyl] (5S)-5-(phenylmethoxymethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C(=O)OC/C=C/CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C40H53NO6Si/c1-39(2,3)47-38(43)41-33(31-44-30-32-20-12-9-13-21-32)26-27-36(41)37(42)45-28-18-7-8-19-29-46-48(40(4,5)6,34-22-14-10-15-23-34)35-24-16-11-17-25-35/h7,9-18,20-25,33,36H,8,19,26-31H2,1-6H3/b18-7+/t33-,36?/m0/s1 |
| InChIKey | SEZWZUUKVFQFQX-YQJSUKNPSA-N |
| XLogP | 7.43 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.95 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|