C37H39N3O8S2 — CID 11636228
[7-(4-benzylpiperidin-1-yl)sulfonyl-3,4-dihydro-1H-isoquinolin-2-yl]-[5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-2,3,4-trihydroxyphenyl]methanone (PubChem CID 11636228) has the molecular formula C37H39N3O8S2 and a molecular weight of 717.87 g/mol. Its IUPAC name is [7-(4-benzylpiperidin-1-yl)sulfonyl-3,4-dihydro-1H-isoquinolin-2-yl]-[5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-2,3,4-trihydroxyphenyl]methanone.
| Compound Name | [7-(4-benzylpiperidin-1-yl)sulfonyl-3,4-dihydro-1H-isoquinolin-2-yl]-[5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-2,3,4-trihydroxyphenyl]methanone |
|---|---|
| PubChem CID | 11636228 |
| Molecular Formula | C37H39N3O8S2 |
| Molecular Weight | 717.87 g/mol |
| Exact Mass | 717.22 |
| IUPAC Name | [7-(4-benzylpiperidin-1-yl)sulfonyl-3,4-dihydro-1H-isoquinolin-2-yl]-[5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-2,3,4-trihydroxyphenyl]methanone |
| SMILES | O=C(c1cc(S(=O)(=O)N2CCc3ccccc3C2)c(O)c(O)c1O)N1CCc2ccc(S(=O)(=O)N3CCC(Cc4ccccc4)CC3)cc2C1 |
| InChI | InChI=1S/C37H39N3O8S2/c41-34-32(22-33(35(42)36(34)43)50(47,48)40-19-15-27-8-4-5-9-29(27)24-40)37(44)38-16-14-28-10-11-31(21-30(28)23-38)49(45,46)39-17-12-26(13-18-39)20-25-6-2-1-3-7-25/h1-11,21-22,26,41-43H,12-20,23-24H2 |
| InChIKey | XNWGWEJDYQCKGI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 155.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.87 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|