C58H52O10S2 — CID 11636582
[4-[2-[(2S,4R,6S)-6-[4-(benzenesulfonyloxy)phenyl]-4-[2,4,6-tris(phenylmethoxy)phenyl]oxan-2-yl]ethyl]phenyl] benzenesulfonate (PubChem CID 11636582) has the molecular formula C58H52O10S2 and a molecular weight of 973.18 g/mol. Its IUPAC name is [4-[2-[(2S,4R,6S)-6-[4-(benzenesulfonyloxy)phenyl]-4-[2,4,6-tris(phenylmethoxy)phenyl]oxan-2-yl]ethyl]phenyl] benzenesulfonate.
| Compound Name | [4-[2-[(2S,4R,6S)-6-[4-(benzenesulfonyloxy)phenyl]-4-[2,4,6-tris(phenylmethoxy)phenyl]oxan-2-yl]ethyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 11636582 |
| Molecular Formula | C58H52O10S2 |
| Molecular Weight | 973.18 g/mol |
| Exact Mass | 972.30 |
| IUPAC Name | [4-[2-[(2S,4R,6S)-6-[4-(benzenesulfonyloxy)phenyl]-4-[2,4,6-tris(phenylmethoxy)phenyl]oxan-2-yl]ethyl]phenyl] benzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(CC[C@H]2C[C@@H](c3c(OCc4ccccc4)cc(OCc4ccccc4)cc3OCc3ccccc3)C[C@@H](c3ccc(OS(=O)(=O)c4ccccc4)cc3)O2)cc1)c1ccccc1 |
| InChI | InChI=1S/C58H52O10S2/c59-69(60,53-22-12-4-13-23-53)67-49-31-26-43(27-32-49)28-33-51-36-48(37-55(66-51)47-29-34-50(35-30-47)68-70(61,62)54-24-14-5-15-25-54)58-56(64-41-45-18-8-2-9-19-45)38-52(63-40-44-16-6-1-7-17-44)39-57(58)65-42-46-20-10-3-11-21-46/h1-27,29-32,34-35,38-39,48,51,55H,28,33,36-37,40-42H2/t48-,51+,55+/m1/s1 |
| InChIKey | GESYACIHLUCRDB-KZGRWZEXSA-N |
| XLogP | 12.60 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.18 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|