About 2-chloro-N,N-dimethylethanamine;hydrochloride
2-chloro-N,N-dimethylethanamine;hydrochloride (PubChem CID 11636816) has the molecular formula C4H11Cl2N
and a molecular weight of 144.04 g/mol. Its IUPAC name is 2-chloro-N,N-dimethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-N,N-dimethylethanamine;hydrochloride |
| PubChem CID | 11636816 |
| Molecular Formula | C4H11Cl2N |
| Molecular Weight | 144.04 g/mol |
| Exact Mass | 143.03 |
| IUPAC Name | 2-chloro-N,N-dimethylethanamine;hydrochloride |
| SMILES | CN(C)CCCl.Cl |
| InChI | InChI=1S/C4H10ClN.ClH/c1-6(2)4-3-5;/h3-4H2,1-2H3;1H |
| InChIKey | LQLJZSJKRYTKTP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.04 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N,N-dimethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-dimethylethanamine;hydrochloride?
The IUPAC name of 2-chloro-N,N-dimethylethanamine;hydrochloride (CID 11636816) is 2-chloro-N,N-dimethylethanamine;hydrochloride.
What is the SMILES notation for 2-chloro-N,N-dimethylethanamine;hydrochloride?
The canonical SMILES for 2-chloro-N,N-dimethylethanamine;hydrochloride is CN(C)CCCl.Cl.
What is the InChIKey of 2-chloro-N,N-dimethylethanamine;hydrochloride?
The InChIKey is LQLJZSJKRYTKTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10ClN.ClH/c1-6(2)4-3-5;/h3-4H2,1-2H3;1H.
What are the key properties of 2-chloro-N,N-dimethylethanamine;hydrochloride?
2-chloro-N,N-dimethylethanamine;hydrochloride has a molecular weight of 144.04 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-dimethylethanamine;hydrochloride is sourced from PubChem (CID 11636816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).