About 5-(1,7-diazaspiro[4.4]nonan-1-yl)-1,2-oxazole
5-(1,7-diazaspiro[4.4]nonan-1-yl)-1,2-oxazole (PubChem CID 11636983) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is 5-(1,7-diazaspiro[4.4]nonan-1-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(1,7-diazaspiro[4.4]nonan-1-yl)-1,2-oxazole |
| PubChem CID | 11636983 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 5-(1,7-diazaspiro[4.4]nonan-1-yl)-1,2-oxazole |
| SMILES | c1cc(N2CCCC23CCNC3)on1 |
| InChI | InChI=1S/C10H15N3O/c1-3-10(4-6-11-8-10)13(7-1)9-2-5-12-14-9/h2,5,11H,1,3-4,6-8H2 |
| InChIKey | ARJBWDBVOQMQBW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,7-diazaspiro[4.4]nonan-1-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,7-diazaspiro[4.4]nonan-1-yl)-1,2-oxazole?
The IUPAC name of 5-(1,7-diazaspiro[4.4]nonan-1-yl)-1,2-oxazole (CID 11636983) is 5-(1,7-diazaspiro[4.4]nonan-1-yl)-1,2-oxazole.
What is the SMILES notation for 5-(1,7-diazaspiro[4.4]nonan-1-yl)-1,2-oxazole?
The canonical SMILES for 5-(1,7-diazaspiro[4.4]nonan-1-yl)-1,2-oxazole is c1cc(N2CCCC23CCNC3)on1.
What is the InChIKey of 5-(1,7-diazaspiro[4.4]nonan-1-yl)-1,2-oxazole?
The InChIKey is ARJBWDBVOQMQBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O/c1-3-10(4-6-11-8-10)13(7-1)9-2-5-12-14-9/h2,5,11H,1,3-4,6-8H2.
What are the key properties of 5-(1,7-diazaspiro[4.4]nonan-1-yl)-1,2-oxazole?
5-(1,7-diazaspiro[4.4]nonan-1-yl)-1,2-oxazole has a molecular weight of 193.25 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,7-diazaspiro[4.4]nonan-1-yl)-1,2-oxazole is sourced from PubChem (CID 11636983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).