About 3-methyl-5-phenyl-2,3-dihydroinden-1-one
3-methyl-5-phenyl-2,3-dihydroinden-1-one (PubChem CID 11637152) has the molecular formula C16H14O
and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-methyl-5-phenyl-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 3-methyl-5-phenyl-2,3-dihydroinden-1-one |
| PubChem CID | 11637152 |
| Molecular Formula | C16H14O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 3-methyl-5-phenyl-2,3-dihydroinden-1-one |
| SMILES | CC1CC(=O)c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C16H14O/c1-11-9-16(17)14-8-7-13(10-15(11)14)12-5-3-2-4-6-12/h2-8,10-11H,9H2,1H3 |
| InChIKey | GJLPABBVXMYOFT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-5-phenyl-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-phenyl-2,3-dihydroinden-1-one?
The IUPAC name of 3-methyl-5-phenyl-2,3-dihydroinden-1-one (CID 11637152) is 3-methyl-5-phenyl-2,3-dihydroinden-1-one.
What is the SMILES notation for 3-methyl-5-phenyl-2,3-dihydroinden-1-one?
The canonical SMILES for 3-methyl-5-phenyl-2,3-dihydroinden-1-one is CC1CC(=O)c2ccc(-c3ccccc3)cc21.
What is the InChIKey of 3-methyl-5-phenyl-2,3-dihydroinden-1-one?
The InChIKey is GJLPABBVXMYOFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O/c1-11-9-16(17)14-8-7-13(10-15(11)14)12-5-3-2-4-6-12/h2-8,10-11H,9H2,1H3.
What are the key properties of 3-methyl-5-phenyl-2,3-dihydroinden-1-one?
3-methyl-5-phenyl-2,3-dihydroinden-1-one has a molecular weight of 222.29 g/mol, XLogP of 4.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-phenyl-2,3-dihydroinden-1-one is sourced from PubChem (CID 11637152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).