About (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methylbut-3-en-1-ol
(1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methylbut-3-en-1-ol (PubChem CID 11637180) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methylbut-3-en-1-ol.
Molecular Properties
| Compound Name | (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methylbut-3-en-1-ol |
| PubChem CID | 11637180 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methylbut-3-en-1-ol |
| SMILES | C=C[C@H](C)[C@@H](O)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C13H22O3/c1-3-10(2)12(14)11-9-15-13(16-11)7-5-4-6-8-13/h3,10-12,14H,1,4-9H2,2H3/t10-,11+,12+/m0/s1 |
| InChIKey | BRKSCMKFXDKAJL-QJPTWQEYSA-N |
| XLogP | 2.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methylbut-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methylbut-3-en-1-ol?
The IUPAC name of (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methylbut-3-en-1-ol (CID 11637180) is (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methylbut-3-en-1-ol.
What is the SMILES notation for (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methylbut-3-en-1-ol?
The canonical SMILES for (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methylbut-3-en-1-ol is C=C[C@H](C)[C@@H](O)[C@H]1COC2(CCCCC2)O1.
What is the InChIKey of (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methylbut-3-en-1-ol?
The InChIKey is BRKSCMKFXDKAJL-QJPTWQEYSA-N. The full InChI is InChI=1S/C13H22O3/c1-3-10(2)12(14)11-9-15-13(16-11)7-5-4-6-8-13/h3,10-12,14H,1,4-9H2,2H3/t10-,11+,12+/m0/s1.
What are the key properties of (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methylbut-3-en-1-ol?
(1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methylbut-3-en-1-ol has a molecular weight of 226.32 g/mol, XLogP of 2.25, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-methylbut-3-en-1-ol is sourced from PubChem (CID 11637180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).