C12H16O3S — CID 11637297
[(4E,6E)-8-methoxy-2-methyl-8-sulfanylideneocta-2,4,6-trien-3-yl] acetate (PubChem CID 11637297) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is [(4E,6E)-8-methoxy-2-methyl-8-sulfanylideneocta-2,4,6-trien-3-yl] acetate.
| Compound Name | [(4E,6E)-8-methoxy-2-methyl-8-sulfanylideneocta-2,4,6-trien-3-yl] acetate |
|---|---|
| PubChem CID | 11637297 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | [(4E,6E)-8-methoxy-2-methyl-8-sulfanylideneocta-2,4,6-trien-3-yl] acetate |
| SMILES | COC(=S)/C=C/C=C/C(OC(C)=O)=C(C)C |
| InChI | InChI=1S/C12H16O3S/c1-9(2)11(15-10(3)13)7-5-6-8-12(16)14-4/h5-8H,1-4H3/b7-5+,8-6+ |
| InChIKey | FGHSDBIBVTXVEA-KQQUZDAGSA-N |
| XLogP | 2.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|