C17H32O2Si — CID 11637955
(5R,6S,9S,10S)-6-methyl-9-propan-2-yl-10-trimethylsilyloxyspiro[4.5]decan-3-one (PubChem CID 11637955) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is (5R,6S,9S,10S)-6-methyl-9-propan-2-yl-10-trimethylsilyloxyspiro[4.5]decan-3-one.
| Compound Name | (5R,6S,9S,10S)-6-methyl-9-propan-2-yl-10-trimethylsilyloxyspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 11637955 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (5R,6S,9S,10S)-6-methyl-9-propan-2-yl-10-trimethylsilyloxyspiro[4.5]decan-3-one |
| SMILES | CC(C)[C@@H]1CC[C@H](C)[C@]2(CCC(=O)C2)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-12(2)15-8-7-13(3)17(10-9-14(18)11-17)16(15)19-20(4,5)6/h12-13,15-16H,7-11H2,1-6H3/t13-,15-,16-,17+/m0/s1 |
| InChIKey | IARXSGNLYPYGRM-QSPRXWTASA-N |
| XLogP | 4.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|