About 9-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)-8,8-dimethylnonan-2-one
9-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)-8,8-dimethylnonan-2-one (PubChem CID 11638232) has the molecular formula C19H38O3
and a molecular weight of 314.51 g/mol. Its IUPAC name is 9-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)-8,8-dimethylnonan-2-one.
Molecular Properties
| Compound Name | 9-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)-8,8-dimethylnonan-2-one |
| PubChem CID | 11638232 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | 9-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)-8,8-dimethylnonan-2-one |
| SMILES | CC(=O)C(CCCCC(C)(C)CO)CCCCC(C)(C)CO |
| InChI | InChI=1S/C19H38O3/c1-16(22)17(10-6-8-12-18(2,3)14-20)11-7-9-13-19(4,5)15-21/h17,20-21H,6-15H2,1-5H3 |
| InChIKey | HZKWZWPUKXZEEW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)-8,8-dimethylnonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)-8,8-dimethylnonan-2-one?
The IUPAC name of 9-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)-8,8-dimethylnonan-2-one (CID 11638232) is 9-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)-8,8-dimethylnonan-2-one.
What is the SMILES notation for 9-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)-8,8-dimethylnonan-2-one?
The canonical SMILES for 9-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)-8,8-dimethylnonan-2-one is CC(=O)C(CCCCC(C)(C)CO)CCCCC(C)(C)CO.
What is the InChIKey of 9-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)-8,8-dimethylnonan-2-one?
The InChIKey is HZKWZWPUKXZEEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O3/c1-16(22)17(10-6-8-12-18(2,3)14-20)11-7-9-13-19(4,5)15-21/h17,20-21H,6-15H2,1-5H3.
What are the key properties of 9-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)-8,8-dimethylnonan-2-one?
9-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)-8,8-dimethylnonan-2-one has a molecular weight of 314.51 g/mol, XLogP of 4.35, 13 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-3-(6-hydroxy-5,5-dimethylhexyl)-8,8-dimethylnonan-2-one is sourced from PubChem (CID 11638232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).