About 2-(dimethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol
2-(dimethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol (PubChem CID 11638319) has the molecular formula C20H21N3O
and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-(dimethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol.
Molecular Properties
| Compound Name | 2-(dimethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol |
| PubChem CID | 11638319 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 2-(dimethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol |
| SMILES | CN(C)C(c1ccccc1)C(O)(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C20H21N3O/c1-23(2)19(16-8-4-3-5-9-16)20(24,17-10-6-12-21-14-17)18-11-7-13-22-15-18/h3-15,19,24H,1-2H3 |
| InChIKey | JPKILPNLNPLMOZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(dimethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol?
The IUPAC name of 2-(dimethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol (CID 11638319) is 2-(dimethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol.
What is the SMILES notation for 2-(dimethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol?
The canonical SMILES for 2-(dimethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol is CN(C)C(c1ccccc1)C(O)(c1cccnc1)c1cccnc1.
What is the InChIKey of 2-(dimethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol?
The InChIKey is JPKILPNLNPLMOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O/c1-23(2)19(16-8-4-3-5-9-16)20(24,17-10-6-12-21-14-17)18-11-7-13-22-15-18/h3-15,19,24H,1-2H3.
What are the key properties of 2-(dimethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol?
2-(dimethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol has a molecular weight of 319.41 g/mol, XLogP of 3.02, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-2-phenyl-1,1-dipyridin-3-ylethanol is sourced from PubChem (CID 11638319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).