C14H24F3NO4 — CID 11638445
tert-butyl N-[(1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3,3-trifluoro-2-methylpropyl]carbamate (PubChem CID 11638445) has the molecular formula C14H24F3NO4 and a molecular weight of 327.34 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3,3-trifluoro-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3,3-trifluoro-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 11638445 |
| Molecular Formula | C14H24F3NO4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | tert-butyl N-[(1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3,3-trifluoro-2-methylpropyl]carbamate |
| SMILES | C[C@@H]([C@@H](NC(=O)OC(C)(C)C)[C@H]1COC(C)(C)O1)C(F)(F)F |
| InChI | InChI=1S/C14H24F3NO4/c1-8(14(15,16)17)10(9-7-20-13(5,6)21-9)18-11(19)22-12(2,3)4/h8-10H,7H2,1-6H3,(H,18,19)/t8-,9+,10+/m0/s1 |
| InChIKey | ZUFVWOUVYHLSAC-IVZWLZJFSA-N |
| XLogP | 3.23 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |