C19H33NO4 — CID 11638665
methyl (2S,5E)-6,10-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]undeca-5,9-dienoate (PubChem CID 11638665) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is methyl (2S,5E)-6,10-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]undeca-5,9-dienoate.
| Compound Name | methyl (2S,5E)-6,10-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]undeca-5,9-dienoate |
|---|---|
| PubChem CID | 11638665 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | methyl (2S,5E)-6,10-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]undeca-5,9-dienoate |
| SMILES | COC(=O)[C@H](CC/C=C(\C)CCC=C(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H33NO4/c1-14(2)10-8-11-15(3)12-9-13-16(17(21)23-7)20-18(22)24-19(4,5)6/h10,12,16H,8-9,11,13H2,1-7H3,(H,20,22)/b15-12+/t16-/m0/s1 |
| InChIKey | INYWVXWSTFWLQW-STTHAQSSSA-N |
| XLogP | 4.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|