C17H32O5Si — CID 11638770
trans-(3R,4E,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-[3-(methoxymethoxy)propylidene]cyclohexan-1-one (PubChem CID 11638770) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is trans-(3R,4E,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-[3-(methoxymethoxy)propylidene]cyclohexan-1-one.
| Compound Name | trans-(3R,4E,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-[3-(methoxymethoxy)propylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 11638770 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | trans-(3R,4E,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4-[3-(methoxymethoxy)propylidene]cyclohexan-1-one |
| SMILES | COCOCC/C=C1\[C@H](O)CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O5Si/c1-17(2,3)23(5,6)22-16-11-13(18)10-15(19)14(16)8-7-9-21-12-20-4/h8,15-16,19H,7,9-12H2,1-6H3/b14-8+/t15-,16-/m1/s1 |
| InChIKey | FGPQLSMRPIGXLB-RCVIBLRSSA-N |
| XLogP | 3.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|