C24H30N2 — CID 11638798
(1R,3R,4R)-2,5-bis[(1S)-1-phenylethyl]-3-prop-2-enyl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 11638798) has the molecular formula C24H30N2 and a molecular weight of 346.52 g/mol. Its IUPAC name is (1R,3R,4R)-2,5-bis[(1S)-1-phenylethyl]-3-prop-2-enyl-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1R,3R,4R)-2,5-bis[(1S)-1-phenylethyl]-3-prop-2-enyl-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 11638798 |
| Molecular Formula | C24H30N2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (1R,3R,4R)-2,5-bis[(1S)-1-phenylethyl]-3-prop-2-enyl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | C=CC[C@@H]1[C@H]2C[C@H](CN2[C@@H](C)c2ccccc2)N1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C24H30N2/c1-4-11-23-24-16-22(26(23)19(3)21-14-9-6-10-15-21)17-25(24)18(2)20-12-7-5-8-13-20/h4-10,12-15,18-19,22-24H,1,11,16-17H2,2-3H3/t18-,19-,22+,23+,24+/m0/s1 |
| InChIKey | FOGJWZFQNMXPOJ-LDIXRSFVSA-N |
| XLogP | 5.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|