C18H12F3N3O2 — CID 11639055
6-amino-1-(4-amino-3,5-difluorophenyl)-5-(4-fluorobenzoyl)pyridin-2-one (PubChem CID 11639055) has the molecular formula C18H12F3N3O2 and a molecular weight of 359.31 g/mol. Its IUPAC name is 6-amino-1-(4-amino-3,5-difluorophenyl)-5-(4-fluorobenzoyl)pyridin-2-one.
| Compound Name | 6-amino-1-(4-amino-3,5-difluorophenyl)-5-(4-fluorobenzoyl)pyridin-2-one |
|---|---|
| PubChem CID | 11639055 |
| Molecular Formula | C18H12F3N3O2 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 6-amino-1-(4-amino-3,5-difluorophenyl)-5-(4-fluorobenzoyl)pyridin-2-one |
| SMILES | Nc1c(F)cc(-n2c(N)c(C(=O)c3ccc(F)cc3)ccc2=O)cc1F |
| InChI | InChI=1S/C18H12F3N3O2/c19-10-3-1-9(2-4-10)17(26)12-5-6-15(25)24(18(12)23)11-7-13(20)16(22)14(21)8-11/h1-8H,22-23H2 |
| InChIKey | IBIOYYHGSIQKBW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 91.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|