About [1-(3,4-dimethoxyphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] acetate
[1-(3,4-dimethoxyphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] acetate (PubChem CID 11639258) has the molecular formula C21H23NO5
and a molecular weight of 369.42 g/mol. Its IUPAC name is [1-(3,4-dimethoxyphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] acetate.
Molecular Properties
| Compound Name | [1-(3,4-dimethoxyphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] acetate |
| PubChem CID | 11639258 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | [1-(3,4-dimethoxyphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] acetate |
| SMILES | COc1ccc(C(CNC(=O)/C=C/c2ccccc2)OC(C)=O)cc1OC |
| InChI | InChI=1S/C21H23NO5/c1-15(23)27-20(17-10-11-18(25-2)19(13-17)26-3)14-22-21(24)12-9-16-7-5-4-6-8-16/h4-13,20H,14H2,1-3H3,(H,22,24)/b12-9+ |
| InChIKey | XULKPSWLPHAMGU-FMIVXFBMSA-N |
| XLogP | 3.14 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [1-(3,4-dimethoxyphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,4-dimethoxyphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] acetate?
The IUPAC name of [1-(3,4-dimethoxyphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] acetate (CID 11639258) is [1-(3,4-dimethoxyphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] acetate.
What is the SMILES notation for [1-(3,4-dimethoxyphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] acetate?
The canonical SMILES for [1-(3,4-dimethoxyphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] acetate is COc1ccc(C(CNC(=O)/C=C/c2ccccc2)OC(C)=O)cc1OC.
What is the InChIKey of [1-(3,4-dimethoxyphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] acetate?
The InChIKey is XULKPSWLPHAMGU-FMIVXFBMSA-N. The full InChI is InChI=1S/C21H23NO5/c1-15(23)27-20(17-10-11-18(25-2)19(13-17)26-3)14-22-21(24)12-9-16-7-5-4-6-8-16/h4-13,20H,14H2,1-3H3,(H,22,24)/b12-9+.
What are the key properties of [1-(3,4-dimethoxyphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] acetate?
[1-(3,4-dimethoxyphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] acetate has a molecular weight of 369.42 g/mol, XLogP of 3.14, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,4-dimethoxyphenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl] acetate is sourced from PubChem (CID 11639258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).