C19H19N2O4S- — CID 11639319
2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one nitrate (PubChem CID 11639319) has the molecular formula C19H19N2O4S- and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one nitrate.
| Compound Name | 2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one nitrate |
|---|---|
| PubChem CID | 11639319 |
| Molecular Formula | C19H19N2O4S- |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one nitrate |
| SMILES | CN1CCC(=C2c3ccccc3CC(=O)c3sccc32)CC1.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C19H19NOS.NO3/c1-20-9-6-13(7-10-20)18-15-5-3-2-4-14(15)12-17(21)19-16(18)8-11-22-19;2-1(3)4/h2-5,8,11H,6-7,9-10,12H2,1H3;/q;-1 |
| InChIKey | MWBUBDRIJGTMQB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|