C20H14FN3O4 — CID 11639479
5-(1-benzofuran-2-yl)-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 11639479) has the molecular formula C20H14FN3O4 and a molecular weight of 379.35 g/mol. Its IUPAC name is 5-(1-benzofuran-2-yl)-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(1-benzofuran-2-yl)-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11639479 |
| Molecular Formula | C20H14FN3O4 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 5-(1-benzofuran-2-yl)-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CN2Cc3ccc(F)cc3C2=O)(c2cc3ccccc3o2)N1 |
| InChI | InChI=1S/C20H14FN3O4/c21-13-6-5-12-9-24(17(25)14(12)8-13)10-20(18(26)22-19(27)23-20)16-7-11-3-1-2-4-15(11)28-16/h1-8H,9-10H2,(H2,22,23,26,27) |
| InChIKey | UMDLECHMOGKMQD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|