C19H19F6NO — CID 11639715
2-[4-[ethyl(2-phenylethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 11639715) has the molecular formula C19H19F6NO and a molecular weight of 391.36 g/mol. Its IUPAC name is 2-[4-[ethyl(2-phenylethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[ethyl(2-phenylethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 11639715 |
| Molecular Formula | C19H19F6NO |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-[4-[ethyl(2-phenylethyl)amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCN(CCc1ccccc1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19F6NO/c1-2-26(13-12-14-6-4-3-5-7-14)16-10-8-15(9-11-16)17(27,18(20,21)22)19(23,24)25/h3-11,27H,2,12-13H2,1H3 |
| InChIKey | AHHXWYOHMGBGIR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|