C22H27N5O2 — CID 11639779
1-(6-methoxy-3-pyridinyl)-3-[2-[2-(4-methylpiperazin-1-yl)phenyl]ethyl]imidazol-2-one (PubChem CID 11639779) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-(6-methoxy-3-pyridinyl)-3-[2-[2-(4-methylpiperazin-1-yl)phenyl]ethyl]imidazol-2-one.
| Compound Name | 1-(6-methoxy-3-pyridinyl)-3-[2-[2-(4-methylpiperazin-1-yl)phenyl]ethyl]imidazol-2-one |
|---|---|
| PubChem CID | 11639779 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 1-(6-methoxy-3-pyridinyl)-3-[2-[2-(4-methylpiperazin-1-yl)phenyl]ethyl]imidazol-2-one |
| SMILES | COc1ccc(-n2ccn(CCc3ccccc3N3CCN(C)CC3)c2=O)cn1 |
| InChI | InChI=1S/C22H27N5O2/c1-24-11-13-25(14-12-24)20-6-4-3-5-18(20)9-10-26-15-16-27(22(26)28)19-7-8-21(29-2)23-17-19/h3-8,15-17H,9-14H2,1-2H3 |
| InChIKey | NESHNWOMURTJLX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |