C22H46O2Si2 — CID 11639893
(2R,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-tri(propan-2-yl)silylhex-5-yn-3-ol (PubChem CID 11639893) has the molecular formula C22H46O2Si2 and a molecular weight of 398.78 g/mol. Its IUPAC name is (2R,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-tri(propan-2-yl)silylhex-5-yn-3-ol.
| Compound Name | (2R,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-tri(propan-2-yl)silylhex-5-yn-3-ol |
|---|---|
| PubChem CID | 11639893 |
| Molecular Formula | C22H46O2Si2 |
| Molecular Weight | 398.78 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | (2R,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-tri(propan-2-yl)silylhex-5-yn-3-ol |
| SMILES | CC(C)[Si](C#C[C@@H](C)[C@@H](O)[C@@H](C)O[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H46O2Si2/c1-16(2)26(17(3)4,18(5)6)15-14-19(7)21(23)20(8)24-25(12,13)22(9,10)11/h16-21,23H,1-13H3/t19-,20-,21-/m1/s1 |
| InChIKey | QCDYATCWAPNNQY-NJDAHSKKSA-N |
| XLogP | 6.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.78 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|