About [(2Z)-2-(6,6-dimethoxyhexylidene)cycloheptyl]oxy-tri(propan-2-yl)silane
[(2Z)-2-(6,6-dimethoxyhexylidene)cycloheptyl]oxy-tri(propan-2-yl)silane (PubChem CID 11640215) has the molecular formula C24H48O3Si
and a molecular weight of 412.73 g/mol. Its IUPAC name is [(2Z)-2-(6,6-dimethoxyhexylidene)cycloheptyl]oxy-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(2Z)-2-(6,6-dimethoxyhexylidene)cycloheptyl]oxy-tri(propan-2-yl)silane |
| PubChem CID | 11640215 |
| Molecular Formula | C24H48O3Si |
| Molecular Weight | 412.73 g/mol |
| Exact Mass | 412.34 |
| IUPAC Name | [(2Z)-2-(6,6-dimethoxyhexylidene)cycloheptyl]oxy-tri(propan-2-yl)silane |
| SMILES | COC(CCCC/C=C1/CCCCCC1O[Si](C(C)C)(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C24H48O3Si/c1-19(2)28(20(3)4,21(5)6)27-23-17-13-9-11-15-22(23)16-12-10-14-18-24(25-7)26-8/h16,19-21,23-24H,9-15,17-18H2,1-8H3/b22-16- |
| InChIKey | GOSLZCAPRVBVJN-JWGURIENSA-N |
| XLogP | 7.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.73 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-2-(6,6-dimethoxyhexylidene)cycloheptyl]oxy-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-2-(6,6-dimethoxyhexylidene)cycloheptyl]oxy-tri(propan-2-yl)silane?
The IUPAC name of [(2Z)-2-(6,6-dimethoxyhexylidene)cycloheptyl]oxy-tri(propan-2-yl)silane (CID 11640215) is [(2Z)-2-(6,6-dimethoxyhexylidene)cycloheptyl]oxy-tri(propan-2-yl)silane.
What is the SMILES notation for [(2Z)-2-(6,6-dimethoxyhexylidene)cycloheptyl]oxy-tri(propan-2-yl)silane?
The canonical SMILES for [(2Z)-2-(6,6-dimethoxyhexylidene)cycloheptyl]oxy-tri(propan-2-yl)silane is COC(CCCC/C=C1/CCCCCC1O[Si](C(C)C)(C(C)C)C(C)C)OC.
What is the InChIKey of [(2Z)-2-(6,6-dimethoxyhexylidene)cycloheptyl]oxy-tri(propan-2-yl)silane?
The InChIKey is GOSLZCAPRVBVJN-JWGURIENSA-N. The full InChI is InChI=1S/C24H48O3Si/c1-19(2)28(20(3)4,21(5)6)27-23-17-13-9-11-15-22(23)16-12-10-14-18-24(25-7)26-8/h16,19-21,23-24H,9-15,17-18H2,1-8H3/b22-16-.
What are the key properties of [(2Z)-2-(6,6-dimethoxyhexylidene)cycloheptyl]oxy-tri(propan-2-yl)silane?
[(2Z)-2-(6,6-dimethoxyhexylidene)cycloheptyl]oxy-tri(propan-2-yl)silane has a molecular weight of 412.73 g/mol, XLogP of 7.62, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-2-(6,6-dimethoxyhexylidene)cycloheptyl]oxy-tri(propan-2-yl)silane is sourced from PubChem (CID 11640215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).