C17H32F3NO5Si — CID 11640276
(2S)-2-amino-1-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-4-methylpentan-1-one;2,2,2-trifluoroacetic acid (PubChem CID 11640276) has the molecular formula C17H32F3NO5Si and a molecular weight of 415.53 g/mol. Its IUPAC name is (2S)-2-amino-1-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-4-methylpentan-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-amino-1-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-4-methylpentan-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11640276 |
| Molecular Formula | C17H32F3NO5Si |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (2S)-2-amino-1-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-4-methylpentan-1-one;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)C[C@H](N)C(=O)[C@]1(CO[Si](C)(C)C(C)(C)C)CO1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H31NO3Si.C2HF3O2/c1-11(2)8-12(16)13(17)15(9-18-15)10-19-20(6,7)14(3,4)5;3-2(4,5)1(6)7/h11-12H,8-10,16H2,1-7H3;(H,6,7)/t12-,15+;/m0./s1 |
| InChIKey | JRDOSTNQMYAMHW-SBKWZQTDSA-N |
| XLogP | 3.35 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|