C21H28N2O7 — CID 11640363
6-(7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1(17),2,4-trien-4-yloxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 11640363) has the molecular formula C21H28N2O7 and a molecular weight of 420.46 g/mol. Its IUPAC name is 6-(7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1(17),2,4-trien-4-yloxy)-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-(7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1(17),2,4-trien-4-yloxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 11640363 |
| Molecular Formula | C21H28N2O7 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 6-(7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1(17),2,4-trien-4-yloxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)C1OC(Oc2ccc3c4c2CNCCN4CC2CCCC32)C(O)C(O)C1O |
| InChI | InChI=1S/C21H28N2O7/c24-16-17(25)19(20(27)28)30-21(18(16)26)29-14-5-4-12-11-3-1-2-10(11)9-23-7-6-22-8-13(14)15(12)23/h4-5,10-11,16-19,21-22,24-26H,1-3,6-9H2,(H,27,28) |
| InChIKey | QFOFKLCGZLFPOY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |