C25H32N2O4 — CID 11640437
(4aR,10bR)-6-(4,6-diethoxy-3-pyridinyl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridine (PubChem CID 11640437) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is (4aR,10bR)-6-(4,6-diethoxy-3-pyridinyl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridine.
| Compound Name | (4aR,10bR)-6-(4,6-diethoxy-3-pyridinyl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridine |
|---|---|
| PubChem CID | 11640437 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (4aR,10bR)-6-(4,6-diethoxy-3-pyridinyl)-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridine |
| SMILES | CCOc1cc(OCC)c(C2=N[C@@H]3CCCC[C@@H]3c3cc(OCC)c(OC)cc32)cn1 |
| InChI | InChI=1S/C25H32N2O4/c1-5-29-21-14-24(31-7-3)26-15-19(21)25-18-13-22(28-4)23(30-6-2)12-17(18)16-10-8-9-11-20(16)27-25/h12-16,20H,5-11H2,1-4H3/t16-,20-/m1/s1 |
| InChIKey | WMOBYMQMPGPPJX-OXQOHEQNSA-N |
| XLogP | 5.16 |
| TPSA | 62.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |