C23H25NO5 — CID 11640587
(3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]piperidin-4-one (PubChem CID 11640587) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 11640587 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (3E,5E)-3,5-bis[(3,4-dimethoxyphenyl)methylidene]piperidin-4-one |
| SMILES | COc1ccc(/C=C2\CNC/C(=C\c3ccc(OC)c(OC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C23H25NO5/c1-26-19-7-5-15(11-21(19)28-3)9-17-13-24-14-18(23(17)25)10-16-6-8-20(27-2)22(12-16)29-4/h5-12,24H,13-14H2,1-4H3/b17-9+,18-10+ |
| InChIKey | KNXCHAFCSTUPHS-BEQMOXJMSA-N |
| XLogP | 3.36 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|