About 1-[5,7-bis(methoxymethoxy)-2,2-dimethylchromen-8-yl]ethoxy-tert-butyl-dimethylsilane
1-[5,7-bis(methoxymethoxy)-2,2-dimethylchromen-8-yl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 11640705) has the molecular formula C23H38O6Si
and a molecular weight of 438.64 g/mol. Its IUPAC name is 1-[5,7-bis(methoxymethoxy)-2,2-dimethylchromen-8-yl]ethoxy-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | 1-[5,7-bis(methoxymethoxy)-2,2-dimethylchromen-8-yl]ethoxy-tert-butyl-dimethylsilane |
| PubChem CID | 11640705 |
| Molecular Formula | C23H38O6Si |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 1-[5,7-bis(methoxymethoxy)-2,2-dimethylchromen-8-yl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | COCOc1cc(OCOC)c(C(C)O[Si](C)(C)C(C)(C)C)c2c1C=CC(C)(C)O2 |
| InChI | InChI=1S/C23H38O6Si/c1-16(29-30(9,10)22(2,3)4)20-19(27-15-25-8)13-18(26-14-24-7)17-11-12-23(5,6)28-21(17)20/h11-13,16H,14-15H2,1-10H3 |
| InChIKey | KSKPRHHYDZKNNC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[5,7-bis(methoxymethoxy)-2,2-dimethylchromen-8-yl]ethoxy-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5,7-bis(methoxymethoxy)-2,2-dimethylchromen-8-yl]ethoxy-tert-butyl-dimethylsilane?
The IUPAC name of 1-[5,7-bis(methoxymethoxy)-2,2-dimethylchromen-8-yl]ethoxy-tert-butyl-dimethylsilane (CID 11640705) is 1-[5,7-bis(methoxymethoxy)-2,2-dimethylchromen-8-yl]ethoxy-tert-butyl-dimethylsilane.
What is the SMILES notation for 1-[5,7-bis(methoxymethoxy)-2,2-dimethylchromen-8-yl]ethoxy-tert-butyl-dimethylsilane?
The canonical SMILES for 1-[5,7-bis(methoxymethoxy)-2,2-dimethylchromen-8-yl]ethoxy-tert-butyl-dimethylsilane is COCOc1cc(OCOC)c(C(C)O[Si](C)(C)C(C)(C)C)c2c1C=CC(C)(C)O2.
What is the InChIKey of 1-[5,7-bis(methoxymethoxy)-2,2-dimethylchromen-8-yl]ethoxy-tert-butyl-dimethylsilane?
The InChIKey is KSKPRHHYDZKNNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H38O6Si/c1-16(29-30(9,10)22(2,3)4)20-19(27-15-25-8)13-18(26-14-24-7)17-11-12-23(5,6)28-21(17)20/h11-13,16H,14-15H2,1-10H3.
What are the key properties of 1-[5,7-bis(methoxymethoxy)-2,2-dimethylchromen-8-yl]ethoxy-tert-butyl-dimethylsilane?
1-[5,7-bis(methoxymethoxy)-2,2-dimethylchromen-8-yl]ethoxy-tert-butyl-dimethylsilane has a molecular weight of 438.64 g/mol, XLogP of 5.92, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5,7-bis(methoxymethoxy)-2,2-dimethylchromen-8-yl]ethoxy-tert-butyl-dimethylsilane is sourced from PubChem (CID 11640705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).