C21H38O8Si — CID 11640886
(3'aR,4R,4'R,6'S,7'aS)-4'-[tert-butyl(dimethyl)silyl]oxy-6'-(methoxymethoxy)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,7'-3a,4,6,7a-tetrahydro-1,3-benzodioxole]-5'-one (PubChem CID 11640886) has the molecular formula C21H38O8Si and a molecular weight of 446.61 g/mol. Its IUPAC name is (3'aR,4R,4'R,6'S,7'aS)-4'-[tert-butyl(dimethyl)silyl]oxy-6'-(methoxymethoxy)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,7'-3a,4,6,7a-tetrahydro-1,3-benzodioxole]-5'-one.
| Compound Name | (3'aR,4R,4'R,6'S,7'aS)-4'-[tert-butyl(dimethyl)silyl]oxy-6'-(methoxymethoxy)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,7'-3a,4,6,7a-tetrahydro-1,3-benzodioxole]-5'-one |
|---|---|
| PubChem CID | 11640886 |
| Molecular Formula | C21H38O8Si |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | (3'aR,4R,4'R,6'S,7'aS)-4'-[tert-butyl(dimethyl)silyl]oxy-6'-(methoxymethoxy)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,7'-3a,4,6,7a-tetrahydro-1,3-benzodioxole]-5'-one |
| SMILES | COCO[C@@H]1C(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2[C@]12COC(C)(C)O2 |
| InChI | InChI=1S/C21H38O8Si/c1-18(2,3)30(9,10)28-14-13(22)16(24-12-23-8)21(11-25-19(4,5)29-21)17-15(14)26-20(6,7)27-17/h14-17H,11-12H2,1-10H3/t14-,15-,16+,17-,21-/m0/s1 |
| InChIKey | BNXIFWRNXSAYBX-QYRAFCHESA-N |
| XLogP | 2.99 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|