C23H16ClFN6O — CID 11640889
N-(4-(3-fluorobenzyloxy)-3-chlorophenyl)-5-(2-(2-aminopyrimidin-4-yl)ethynyl)pyrimidin-4-amine (PubChem CID 11640889) has the molecular formula C23H16ClFN6O and a molecular weight of 446.90 g/mol. Its IUPAC name is 4-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]pyrimidin-5-yl]ethynyl]pyrimidin-2-amine.
| Compound Name | N-(4-(3-fluorobenzyloxy)-3-chlorophenyl)-5-(2-(2-aminopyrimidin-4-yl)ethynyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 11640889 |
| Molecular Formula | C23H16ClFN6O |
| Molecular Weight | 446.90 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 4-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]pyrimidin-5-yl]ethynyl]pyrimidin-2-amine |
| SMILES | C1=CC(=CC(=C1)F)COC2=C(C=C(C=C2)NC3=NC=NC=C3C#CC4=NC(=NC=C4)N)Cl |
| InChI | InChI=1S/C23H16ClFN6O/c24-20-11-19(6-7-21(20)32-13-15-2-1-3-17(25)10-15)30-22-16(12-27-14-29-22)4-5-18-8-9-28-23(26)31-18/h1-3,6-12,14H,13H2,(H2,26,28,31)(H,27,29,30) |
| InChIKey | WRXRFFUVXFNKGG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 98.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | 659 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|