About 2-methoxyethyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)azepane-1-carboxylate
2-methoxyethyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)azepane-1-carboxylate (PubChem CID 11640903) has the molecular formula C24H34FN3O4
and a molecular weight of 447.55 g/mol. Its IUPAC name is 2-methoxyethyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)azepane-1-carboxylate.
Molecular Properties
| Compound Name | 2-methoxyethyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)azepane-1-carboxylate |
| PubChem CID | 11640903 |
| Molecular Formula | C24H34FN3O4 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 2-methoxyethyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)azepane-1-carboxylate |
| SMILES | COCCOC(=O)N1CCCC(N2CCC3(CC2)CN(C(C)=O)c2ccc(F)cc23)CC1 |
| InChI | InChI=1S/C24H34FN3O4/c1-18(29)28-17-24(21-16-19(25)5-6-22(21)28)8-12-26(13-9-24)20-4-3-10-27(11-7-20)23(30)32-15-14-31-2/h5-6,16,20H,3-4,7-15,17H2,1-2H3 |
| InChIKey | HTLWLSVXASDMHX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)azepane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)azepane-1-carboxylate?
The IUPAC name of 2-methoxyethyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)azepane-1-carboxylate (CID 11640903) is 2-methoxyethyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)azepane-1-carboxylate.
What is the SMILES notation for 2-methoxyethyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)azepane-1-carboxylate?
The canonical SMILES for 2-methoxyethyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)azepane-1-carboxylate is COCCOC(=O)N1CCCC(N2CCC3(CC2)CN(C(C)=O)c2ccc(F)cc23)CC1.
What is the InChIKey of 2-methoxyethyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)azepane-1-carboxylate?
The InChIKey is HTLWLSVXASDMHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34FN3O4/c1-18(29)28-17-24(21-16-19(25)5-6-22(21)28)8-12-26(13-9-24)20-4-3-10-27(11-7-20)23(30)32-15-14-31-2/h5-6,16,20H,3-4,7-15,17H2,1-2H3.
What are the key properties of 2-methoxyethyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)azepane-1-carboxylate?
2-methoxyethyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)azepane-1-carboxylate has a molecular weight of 447.55 g/mol, XLogP of 3.16, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl 4-(1-acetyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1'-yl)azepane-1-carboxylate is sourced from PubChem (CID 11640903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).