C18H24N6O4S2 — CID 11641010
N-[3-[(16S)-9-amino-14-methylsulfonyl-8,11,14,17-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaen-16-yl]propyl]methanesulfonamide (PubChem CID 11641010) has the molecular formula C18H24N6O4S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[3-[(16S)-9-amino-14-methylsulfonyl-8,11,14,17-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaen-16-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[(16S)-9-amino-14-methylsulfonyl-8,11,14,17-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaen-16-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 11641010 |
| Molecular Formula | C18H24N6O4S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N-[3-[(16S)-9-amino-14-methylsulfonyl-8,11,14,17-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11-hexaen-16-yl]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCC[C@H]1CN(S(C)(=O)=O)Cc2nc3c(N)nc4ccccc4c3n21 |
| InChI | InChI=1S/C18H24N6O4S2/c1-29(25,26)20-9-5-6-12-10-23(30(2,27)28)11-15-22-16-17(24(12)15)13-7-3-4-8-14(13)21-18(16)19/h3-4,7-8,12,20H,5-6,9-11H2,1-2H3,(H2,19,21)/t12-/m0/s1 |
| InChIKey | YWGLEWZFVMSXFN-LBPRGKRZSA-N |
| XLogP | 0.81 |
| TPSA | 140.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|