C19H20Cl2N4O3S — CID 11641062
2-amino-4-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-N-propan-2-ylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 11641062) has the molecular formula C19H20Cl2N4O3S and a molecular weight of 455.37 g/mol. Its IUPAC name is 2-amino-4-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-N-propan-2-ylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-amino-4-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-N-propan-2-ylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 11641062 |
| Molecular Formula | C19H20Cl2N4O3S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 2-amino-4-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-N-propan-2-ylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | COCCOc1cc(-c2nc(N)nc3sc(C(=O)NC(C)C)cc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N4O3S/c1-9(2)23-17(26)15-7-11-16(24-19(22)25-18(11)29-15)10-6-14(28-5-4-27-3)13(21)8-12(10)20/h6-9H,4-5H2,1-3H3,(H,23,26)(H2,22,24,25) |
| InChIKey | YSGXCNLQVXHVCH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|