C17H30ClN11O2 — CID 11641079
3,5-diamino-N-[N'-[4-[4-(2-aminoethylcarbamoyl)piperazin-1-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 11641079) has the molecular formula C17H30ClN11O2 and a molecular weight of 455.96 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-[4-(2-aminoethylcarbamoyl)piperazin-1-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[4-[4-(2-aminoethylcarbamoyl)piperazin-1-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11641079 |
| Molecular Formula | C17H30ClN11O2 |
| Molecular Weight | 455.96 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-[4-(2-aminoethylcarbamoyl)piperazin-1-yl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | NCCNC(=O)N1CCN(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)CC1 |
| InChI | InChI=1S/C17H30ClN11O2/c18-12-14(21)26-13(20)11(25-12)15(30)27-16(22)23-4-1-2-6-28-7-9-29(10-8-28)17(31)24-5-3-19/h1-10,19H2,(H,24,31)(H4,20,21,26)(H3,22,23,27,30) |
| InChIKey | YEWFEBLHVJVPPS-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 206.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.96 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|