C27H43N3O3 — CID 11641110
(2S)-N-[(E,3S)-2,5-dimethyl-6-oxohex-4-en-3-yl]-N,3,3-trimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide (PubChem CID 11641110) has the molecular formula C27H43N3O3 and a molecular weight of 457.66 g/mol. Its IUPAC name is (2S)-N-[(E,3S)-2,5-dimethyl-6-oxohex-4-en-3-yl]-N,3,3-trimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide.
| Compound Name | (2S)-N-[(E,3S)-2,5-dimethyl-6-oxohex-4-en-3-yl]-N,3,3-trimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide |
|---|---|
| PubChem CID | 11641110 |
| Molecular Formula | C27H43N3O3 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.33 |
| IUPAC Name | (2S)-N-[(E,3S)-2,5-dimethyl-6-oxohex-4-en-3-yl]-N,3,3-trimethyl-2-[[(2S)-3-methyl-2-(methylamino)-3-phenylbutanoyl]amino]butanamide |
| SMILES | CN[C@H](C(=O)N[C@H](C(=O)N(C)[C@H](/C=C(\C)C=O)C(C)C)C(C)(C)C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C27H43N3O3/c1-18(2)21(16-19(3)17-31)30(10)25(33)23(26(4,5)6)29-24(32)22(28-9)27(7,8)20-14-12-11-13-15-20/h11-18,21-23,28H,1-10H3,(H,29,32)/b19-16+/t21-,22-,23-/m1/s1 |
| InChIKey | UTNLOOCRJDXVPI-UVAGCALHSA-N |
| XLogP | 3.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|