C25H22ClN5O2S — CID 1164130
N'-[2-[[5-benzyl-4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-phenylacetohydrazide (PubChem CID 1164130) has the molecular formula C25H22ClN5O2S and a molecular weight of 492.00 g/mol. Its IUPAC name is N'-[2-[[5-benzyl-4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-phenylacetohydrazide.
| Compound Name | N'-[2-[[5-benzyl-4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 1164130 |
| Molecular Formula | C25H22ClN5O2S |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | N'-[2-[[5-benzyl-4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-phenylacetohydrazide |
| SMILES | O=C(CSc1nnc(Cc2ccccc2)n1-c1cccc(Cl)c1)NNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C25H22ClN5O2S/c26-20-12-7-13-21(16-20)31-22(14-18-8-3-1-4-9-18)27-30-25(31)34-17-24(33)29-28-23(32)15-19-10-5-2-6-11-19/h1-13,16H,14-15,17H2,(H,28,32)(H,29,33) |
| InChIKey | OCZSFRMPXFKALY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|