C27H27ClN2O4 — CID 11641493
benzoyl benzenecarboperoxoate;2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole;hydrochloride (PubChem CID 11641493) has the molecular formula C27H27ClN2O4 and a molecular weight of 478.98 g/mol. Its IUPAC name is benzoyl benzenecarboperoxoate;2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole;hydrochloride.
| Compound Name | benzoyl benzenecarboperoxoate;2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole;hydrochloride |
|---|---|
| PubChem CID | 11641493 |
| Molecular Formula | C27H27ClN2O4 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | benzoyl benzenecarboperoxoate;2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole;hydrochloride |
| SMILES | Cl.O=C(OOC(=O)c1ccccc1)c1ccccc1.c1ccc2c(c1)CCCC2C1=NCCN1 |
| InChI | InChI=1S/C14H10O4.C13H16N2.ClH/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12;1-2-6-11-10(4-1)5-3-7-12(11)13-14-8-9-15-13;/h1-10H;1-2,4,6,12H,3,5,7-9H2,(H,14,15);1H |
| InChIKey | PORHVFXUIKGPKV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|