C19H19F2IN4O — CID 11641580
2-(2,4-difluorophenyl)-1-[(4-iodophenyl)methyl-methylamino]-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 11641580) has the molecular formula C19H19F2IN4O and a molecular weight of 484.29 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-[(4-iodophenyl)methyl-methylamino]-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-[(4-iodophenyl)methyl-methylamino]-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 11641580 |
| Molecular Formula | C19H19F2IN4O |
| Molecular Weight | 484.29 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-[(4-iodophenyl)methyl-methylamino]-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | CN(Cc1ccc(I)cc1)CC(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H19F2IN4O/c1-25(9-14-2-5-16(22)6-3-14)10-19(27,11-26-13-23-12-24-26)17-7-4-15(20)8-18(17)21/h2-8,12-13,27H,9-11H2,1H3 |
| InChIKey | VDBLUAHBFVLQSJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|