C23H18F6N2O3 — CID 11641582
3-[4-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylindol-1-yl]methyl]-5-methyl-1,3-oxazol-2-yl]phenol (PubChem CID 11641582) has the molecular formula C23H18F6N2O3 and a molecular weight of 484.40 g/mol. Its IUPAC name is 3-[4-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylindol-1-yl]methyl]-5-methyl-1,3-oxazol-2-yl]phenol.
| Compound Name | 3-[4-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylindol-1-yl]methyl]-5-methyl-1,3-oxazol-2-yl]phenol |
|---|---|
| PubChem CID | 11641582 |
| Molecular Formula | C23H18F6N2O3 |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 3-[4-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylindol-1-yl]methyl]-5-methyl-1,3-oxazol-2-yl]phenol |
| SMILES | Cc1oc(-c2cccc(O)c2)nc1Cn1c(C)cc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C23H18F6N2O3/c1-12-8-15-9-16(21(33,22(24,25)26)23(27,28)29)6-7-19(15)31(12)11-18-13(2)34-20(30-18)14-4-3-5-17(32)10-14/h3-10,32-33H,11H2,1-2H3 |
| InChIKey | KNTKZSTYICOKPY-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |