C26H50O5Si2 — CID 11641818
methyl (E)-3-[(1R,2R,3S,5S)-3-[(1S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentyl]-6-oxabicyclo[3.1.0]hexan-2-yl]prop-2-enoate (PubChem CID 11641818) has the molecular formula C26H50O5Si2 and a molecular weight of 498.85 g/mol. Its IUPAC name is methyl (E)-3-[(1R,2R,3S,5S)-3-[(1S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentyl]-6-oxabicyclo[3.1.0]hexan-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(1R,2R,3S,5S)-3-[(1S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentyl]-6-oxabicyclo[3.1.0]hexan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11641818 |
| Molecular Formula | C26H50O5Si2 |
| Molecular Weight | 498.85 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | methyl (E)-3-[(1R,2R,3S,5S)-3-[(1S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentyl]-6-oxabicyclo[3.1.0]hexan-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H]1[C@@H]([C@H](CCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C26H50O5Si2/c1-25(2,3)32(8,9)29-17-13-12-14-21(31-33(10,11)26(4,5)6)20-18-22-24(30-22)19(20)15-16-23(27)28-7/h15-16,19-22,24H,12-14,17-18H2,1-11H3/b16-15+/t19-,20+,21+,22+,24-/m1/s1 |
| InChIKey | ARKCXDFOJJRORM-WSINPDLESA-N |
| XLogP | 6.70 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.85 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|