C27H29N7OS — CID 11641829
N-[(E)-(3-methylphenyl)methylideneamino]-4-[[5-[(3-methylphenyl)methyl]-1,3,4-thiadiazol-2-yl]methyl]-6-morpholin-4-ylpyrimidin-2-amine (PubChem CID 11641829) has the molecular formula C27H29N7OS and a molecular weight of 499.64 g/mol. Its IUPAC name is N-[(E)-(3-methylphenyl)methylideneamino]-4-[[5-[(3-methylphenyl)methyl]-1,3,4-thiadiazol-2-yl]methyl]-6-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-[(E)-(3-methylphenyl)methylideneamino]-4-[[5-[(3-methylphenyl)methyl]-1,3,4-thiadiazol-2-yl]methyl]-6-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 11641829 |
| Molecular Formula | C27H29N7OS |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | N-[(E)-(3-methylphenyl)methylideneamino]-4-[[5-[(3-methylphenyl)methyl]-1,3,4-thiadiazol-2-yl]methyl]-6-morpholin-4-ylpyrimidin-2-amine |
| SMILES | Cc1cccc(/C=N/Nc2nc(Cc3nnc(Cc4cccc(C)c4)s3)cc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C27H29N7OS/c1-19-5-3-7-21(13-19)15-25-31-32-26(36-25)17-23-16-24(34-9-11-35-12-10-34)30-27(29-23)33-28-18-22-8-4-6-20(2)14-22/h3-8,13-14,16,18H,9-12,15,17H2,1-2H3,(H,29,30,33)/b28-18+ |
| InChIKey | JBKXTNFFFFKRON-MTDXEUNCSA-N |
| XLogP | 4.41 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|