About 1-[4,4-bis(4-chlorophenyl)butyl]-4-(4-chlorophenyl)piperidin-4-ol
1-[4,4-bis(4-chlorophenyl)butyl]-4-(4-chlorophenyl)piperidin-4-ol (PubChem CID 11642194) has the molecular formula C27H28Cl3NO
and a molecular weight of 488.89 g/mol. Its IUPAC name is 1-[4,4-bis(4-chlorophenyl)butyl]-4-(4-chlorophenyl)piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[4,4-bis(4-chlorophenyl)butyl]-4-(4-chlorophenyl)piperidin-4-ol |
| PubChem CID | 11642194 |
| Molecular Formula | C27H28Cl3NO |
| Molecular Weight | 488.89 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 1-[4,4-bis(4-chlorophenyl)butyl]-4-(4-chlorophenyl)piperidin-4-ol |
| SMILES | OC1(c2ccc(Cl)cc2)CCN(CCCC(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C27H28Cl3NO/c28-23-9-3-20(4-10-23)26(21-5-11-24(29)12-6-21)2-1-17-31-18-15-27(32,16-19-31)22-7-13-25(30)14-8-22/h3-14,26,32H,1-2,15-19H2 |
| InChIKey | MOQCAQOBFUPMGV-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.89 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4,4-bis(4-chlorophenyl)butyl]-4-(4-chlorophenyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4,4-bis(4-chlorophenyl)butyl]-4-(4-chlorophenyl)piperidin-4-ol?
The IUPAC name of 1-[4,4-bis(4-chlorophenyl)butyl]-4-(4-chlorophenyl)piperidin-4-ol (CID 11642194) is 1-[4,4-bis(4-chlorophenyl)butyl]-4-(4-chlorophenyl)piperidin-4-ol.
What is the SMILES notation for 1-[4,4-bis(4-chlorophenyl)butyl]-4-(4-chlorophenyl)piperidin-4-ol?
The canonical SMILES for 1-[4,4-bis(4-chlorophenyl)butyl]-4-(4-chlorophenyl)piperidin-4-ol is OC1(c2ccc(Cl)cc2)CCN(CCCC(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1.
What is the InChIKey of 1-[4,4-bis(4-chlorophenyl)butyl]-4-(4-chlorophenyl)piperidin-4-ol?
The InChIKey is MOQCAQOBFUPMGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28Cl3NO/c28-23-9-3-20(4-10-23)26(21-5-11-24(29)12-6-21)2-1-17-31-18-15-27(32,16-19-31)22-7-13-25(30)14-8-22/h3-14,26,32H,1-2,15-19H2.
What are the key properties of 1-[4,4-bis(4-chlorophenyl)butyl]-4-(4-chlorophenyl)piperidin-4-ol?
1-[4,4-bis(4-chlorophenyl)butyl]-4-(4-chlorophenyl)piperidin-4-ol has a molecular weight of 488.89 g/mol, XLogP of 7.54, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4,4-bis(4-chlorophenyl)butyl]-4-(4-chlorophenyl)piperidin-4-ol is sourced from PubChem (CID 11642194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).